Sulfamic acid,N-(4-methoxyphenyl)-, sodium salt (1:1)
Sulfamic acid,N-(4-methoxyphenyl)-, sodium salt (1:1) structure
|
Common Name | Sulfamic acid,N-(4-methoxyphenyl)-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5446-07-1 | Molecular Weight | 240.21200 | |
| Density | 1.518g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9N2NaO4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.518g/cm3 |
|---|---|
| Molecular Formula | C7H9N2NaO4S |
| Molecular Weight | 240.21200 |
| Exact Mass | 240.01800 |
| PSA | 98.87000 |
| LogP | 1.61660 |
| Index of Refraction | 1.624 |
| InChIKey | CKYWTHKZADVRRK-UHFFFAOYSA-N |
| SMILES | COc1ccc(NNS(=O)(=O)O)cc1.[Na+] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2928000090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Sodium 4-methoxyphenylhydrazine-N'-sulphonate |
| 4-Methoxyphenylhydrazine-N'-sulphonic acid,sodium salt |
| p-Methoxyphenylhydrazinesulfonic acid sodium salt |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate have? |
| A: English synonyms of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate: Sodium 4-methoxyphenylhydrazine-N'-sulphonate, 4-Methoxyphenylhydrazine-N'-sulphonic acid,sodium salt, p-Methoxyphenylhydrazinesulfonic acid sodium salt. |
| Q: What is the InChIKey of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: InChIKey of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is CKYWTHKZADVRRK-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: Molecular weight of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is 240.21200. |
| Q: What is the CAS number of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: CAS number of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is 5446-07-1. |
| Q: What is the SMILES notation of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: SMILES notation of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is COc1ccc(NNS(=O)(=O)O)cc1.[Na+]. |
| Q: What is the English name of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: The English name of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate. |
| Q: What is the safety information for 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: Safety information for 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate: 26-36. |
| Q: What is the molecular formula of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: Molecular formula of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is C7H9N2NaO4S. |
| Q: What is the polar surface area (PSA) of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: Polar surface area (PSA) of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is 98.87000. |
| Q: What is the LogP of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate? |
| A: LogP of 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate is 1.61660. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |