Sulfamic acid,N-(4-methoxyphenyl)-, sodium salt (1:1) structure
|
Common Name | Sulfamic acid,N-(4-methoxyphenyl)-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5446-07-1 | Molecular Weight | 240.21200 | |
| Density | 1.518g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H9N2NaO4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(4-methoxyphenyl)hydrazinesulfonic acid sodium salt monohydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Molecular Formula | C7H9N2NaO4S |
| Molecular Weight | 240.21200 |
| Exact Mass | 240.01800 |
| PSA | 98.87000 |
| LogP | 1.61660 |
| Index of Refraction | 1.624 |
| InChIKey | CKYWTHKZADVRRK-UHFFFAOYSA-N |
| SMILES | COc1ccc(NNS(=O)(=O)O)cc1.[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2928000090 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
| Sodium 4-methoxyphenylhydrazine-N'-sulphonate |
| 4-Methoxyphenylhydrazine-N'-sulphonic acid,sodium salt |
| p-Methoxyphenylhydrazinesulfonic acid sodium salt |