Benzoic acid,2-[acetyl(2-methoxy-2-oxoethyl)amino]-, methyl ester structure
|
Common Name | Benzoic acid,2-[acetyl(2-methoxy-2-oxoethyl)amino]-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5446-19-5 | Molecular Weight | 265.26200 | |
| Density | 1.231g/cm3 | Boiling Point | 409.7ºC at 760mmHg | |
| Molecular Formula | C13H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.6ºC | |
| Name | methyl 2-[acetyl-(2-methoxy-2-oxoethyl)amino]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.231g/cm3 |
|---|---|
| Boiling Point | 409.7ºC at 760mmHg |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26200 |
| Flash Point | 201.6ºC |
| Exact Mass | 265.09500 |
| PSA | 72.91000 |
| LogP | 0.99910 |
| Index of Refraction | 1.544 |
| InChIKey | UAXPPKOGDZCDIV-UHFFFAOYSA-N |
| SMILES | COC(=O)CN(C(C)=O)c1ccccc1C(=O)OC |
|
~%
Benzoic acid,2-... CAS#:5446-19-5 |
| Literature: Bayer and Co. Patent: DE117059 ; |
|
~%
Benzoic acid,2-... CAS#:5446-19-5 |
| Literature: Bayer and Co. Patent: DE117059 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
| N-Acetyl-N-methoxycarbonylmethyl-anthranilsaeure-methylester |
| N-acetyl-N-methoxycarbonylmethyl-anthranilic acid methyl ester |