1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethyl-methanamine
1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethyl-methanamine structure
|
Common Name | 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethyl-methanamine | ||
|---|---|---|---|---|
| CAS Number | 5446-82-2 | Molecular Weight | 234.29400 | |
| Density | 1.134g/cm3 | Boiling Point | 359.3ºC at 760 mmHg | |
| Molecular Formula | C13H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760 mmHg |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.29400 |
| Flash Point | 171.1ºC |
| Exact Mass | 234.13700 |
| PSA | 37.49000 |
| LogP | 2.24670 |
| Index of Refraction | 1.591 |
| InChIKey | JTWOJYIJQZMOKH-UHFFFAOYSA-N |
| SMILES | COc1cc2[nH]cc(CN(C)C)c2cc1OC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~40%
1-(5,6-dimethox... CAS#:5446-82-2 |
| Literature: Cheng, Alice C.; Shulgin, Alexander T.; Castagnoli, Neal Journal of Organic Chemistry, 1982 , vol. 47, # 27 p. 5258 - 5262 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:16381-44-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,6-dimethoxygramine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: The English name of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine. |
| Q: What is the molecular formula of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: Molecular formula of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is C13H18N2O2. |
| Q: What is the molecular weight of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: Molecular weight of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is 234.29400. |
| Q: What is the polar surface area (PSA) of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: Polar surface area (PSA) of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is 37.49000. |
| Q: What is the CAS number of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: CAS number of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is 5446-82-2. |
| Q: What is the SMILES notation of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: SMILES notation of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is COc1cc2[nH]cc(CN(C)C)c2cc1OC. |
| Q: What English synonyms does 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine have? |
| A: English synonyms of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine: 5,6-dimethoxygramine. |
| Q: What is the Chinese name of 5446-82-2? |
| A: Chinese name of 5446-82-2 is 5446-82-2. |
| Q: What is the LogP of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: LogP of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine is 2.24670. |
| Q: What are the downstream products of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine? |
| A: Related downstream products(CAS) of 1-(5,6-dimethoxy-1H-indol-3-yl)-N,N-dimethylmethanamine: 16381-44-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |