Butanedioic acid,2,2-dimethyl-3-oxo-, 1,4-diethyl ester structure
|
Common Name | Butanedioic acid,2,2-dimethyl-3-oxo-, 1,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5447-64-3 | Molecular Weight | 216.23100 | |
| Density | 1.093g/cm3 | Boiling Point | 276.9ºC at 760mmHg | |
| Molecular Formula | C10H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4ºC | |
| Name | diethyl 2,2-dimethyl-3-oxobutanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 276.9ºC at 760mmHg |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23100 |
| Flash Point | 116.4ºC |
| Exact Mass | 216.10000 |
| PSA | 69.67000 |
| LogP | 0.70790 |
| Index of Refraction | 1.438 |
| InChIKey | JLCIFXYVIHWGNY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C(C)(C)C(=O)OCC |
| HS Code | 2918300090 |
|---|
|
~85%
Butanedioic aci... CAS#:5447-64-3 |
| Literature: Barbaud, Christel; Guerrouache, Mohamed; Guerin, Philippe Tetrahedron Letters, 2002 , vol. 43, # 52 p. 9513 - 9515 |
|
~%
Butanedioic aci... CAS#:5447-64-3 |
| Literature: Hudson; Hauser Journal of the American Chemical Society, 1941 , vol. 63, p. 3158 Org. Reactions, 1942 , vol. 1, p. 288 |
|
~%
Butanedioic aci... CAS#:5447-64-3 |
| Literature: Rassow; Bauer Chemische Berichte, 1908 , vol. 41, p. 965 Journal fuer Praktische Chemie (Leipzig), 1909 , vol. <2> 80, p. 100 |
|
~%
Butanedioic aci... CAS#:5447-64-3 |
| Literature: Lapin,H.; Horeau,A. Gazzetta Chimica Italiana, 1963 , vol. 93, p. 451 - 454 |
|
~%
Butanedioic aci... CAS#:5447-64-3 |
| Literature: Poorker, Carol S.; Kagan, Jacques Tetrahedron Letters, 1985 , vol. 26, # 52 p. 6405 - 6408 |
| Precursor 7 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Dimethyl-oxalessigsaeure-diaethylester |
| dimethyl-oxalacetic acid diethyl ester |
| dimethyl-oxo-succinic acid diethyl ester |
| Diethyl 2,2-dimethyl-3-oxosuccinate |
| diethyl dimethyloxaloacetate |
| diethyl 3,3-dimethyl-2-ketosuccinate |
| Butanedioic acid,2,2-dimethyl-3-oxo-,1,4-diethyl ester |