Benzeneacetic acid, a-hydroxy-2-methyl-a-phenyl- structure
|
Common Name | Benzeneacetic acid, a-hydroxy-2-methyl-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5448-09-9 | Molecular Weight | 242.27000 | |
| Density | 1.244g/cm3 | Boiling Point | 419.2ºC at 760mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.5ºC | |
| Name | 2-hydroxy-2-(2-methylphenyl)-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 419.2ºC at 760mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 221.5ºC |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 2.31550 |
| Index of Refraction | 1.612 |
| InChIKey | AEIGUJIDYBREEB-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(O)(C(=O)O)c1ccccc1 |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-methylbenzilic acid |
| 2-Methyl-benzilsaeure |
| hydroxy-phenyl-o-tolyl-acetic acid |