1H-Pyrrole-2,4-dicarboxylicacid, 5-formyl-3-methyl-, 4-ethyl ester structure
|
Common Name | 1H-Pyrrole-2,4-dicarboxylicacid, 5-formyl-3-methyl-, 4-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5448-14-6 | Molecular Weight | 225.19800 | |
| Density | 1.384g/cm3 | Boiling Point | 508.8ºC at 760mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 4-ethoxycarbonyl-5-formyl-3-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 508.8ºC at 760mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 261.5ºC |
| Exact Mass | 225.06400 |
| PSA | 96.46000 |
| LogP | 1.01050 |
| Index of Refraction | 1.599 |
| InChIKey | LHSGWGYWHJLNRJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C=O)[nH]c(C(=O)O)c1C |
| HS Code | 2933990090 |
|---|
|
~%
1H-Pyrrole-2,4-... CAS#:5448-14-6 |
| Literature: Corwin; Kleinspehn Journal of the American Chemical Society, 1953 , vol. 75, p. 2089,2093 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methyl-3-carbethoxy-5-carboxy-2-formylpyrrole |
| 2-Carboxy-4-ethoxycarbonyl-5-formyl-3-methylpyrrol |
| 5-Formyl-3-methyl-pyrrol-2,4-dicarbonsaeure-4-aethylester |
| 5-formyl-3-methyl-pyrrole-2,4-dicarboxylic acid-4-ethyl ester |
| 4-(ethoxycarbonyl)-5-formyl-3-methyl-1h-pyrrole-2-carboxylic acid |