1H-Pyrrole-2,4-dicarboxylicacid, 5-formyl-3-methyl-, 2,4-diethyl ester structure
|
Common Name | 1H-Pyrrole-2,4-dicarboxylicacid, 5-formyl-3-methyl-, 2,4-diethyl ester | ||
|---|---|---|---|---|
| CAS Number | 2199-60-2 | Molecular Weight | 253.25100 | |
| Density | 1.238g/cm3 | Boiling Point | 439.7ºC at 760mmHg | |
| Molecular Formula | C12H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.7ºC | |
| Name | diethyl 5-formyl-3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 439.7ºC at 760mmHg |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25100 |
| Flash Point | 219.7ºC |
| Exact Mass | 253.09500 |
| PSA | 85.46000 |
| LogP | 1.48900 |
| Vapour Pressure | 6.23E-08mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | WPKKEQCPXUTCDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c(C=O)c(C(=O)OCC)c1C |
| HS Code | 2933990090 |
|---|
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-formyl-3-methyl-pyrrole-2,4-dicarboxylic acid diethyl ester |
| Pyrrole Analogue 1 |
| 5-Formyl-3-methyl-1H-pyrrole-2,4-dicarboxylic acid diethyl ester |
| 3,5-bisethoxycarbonyl-2-formyl-4-methylpyrrole |
| 1H-Pyrrole-2,4-dicarboxylic acid,5-formyl-3-methyl-,diethyl ester |
| 4-Methyl-3,5-dicarbethoxypyrrol-2-aldehyd |
| diethyl 5-formyl-3-methylpyrrole-2,4-dicarboxylate |
| 2-formyl-3,5-bis(ethoxycarbonyl)-4-methylpyrrole |
| diethyl 2-formyl-4-methylpyrrole-3,5-dicarboxylate |