2-ethyl-2-(4-phenylbutyl)propanedioic acid structure
|
Common Name | 2-ethyl-2-(4-phenylbutyl)propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 5449-70-7 | Molecular Weight | 264.31700 | |
| Density | 1.163g/cm3 | Boiling Point | 471.2ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.9ºC | |
| Name | 2-ethyl-2-(4-phenylbutyl)propanedioic acid |
|---|
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 471.2ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 252.9ºC |
| Exact Mass | 264.13600 |
| PSA | 74.60000 |
| LogP | 2.96500 |
| Index of Refraction | 1.54 |
| InChIKey | OWOXROSOVXRMRV-UHFFFAOYSA-N |
| SMILES | CCC(CCCCc1ccccc1)(C(=O)O)C(=O)O |
|
~%
2-ethyl-2-(4-ph... CAS#:5449-70-7 |
| Literature: Blicke; Centolella Journal of the American Chemical Society, 1938 , vol. 60, p. 2923 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |