1-bis(3-nitrophenyl)arsoryl-3-nitro-benzene structure
|
Common Name | 1-bis(3-nitrophenyl)arsoryl-3-nitro-benzene | ||
|---|---|---|---|---|
| CAS Number | 5449-75-2 | Molecular Weight | 457.22500 | |
| Density | N/A | Boiling Point | 652.4ºC at 760 mmHg | |
| Molecular Formula | C18H12AsN3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.5ºC | |
| Name | 1-bis(3-nitrophenyl)arsoryl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 652.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H12AsN3O7 |
| Molecular Weight | 457.22500 |
| Flash Point | 314.5ºC |
| Exact Mass | 456.98900 |
| PSA | 154.53000 |
| LogP | 3.37820 |
| InChIKey | DXHPXSCLXFSXRO-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](=O)(c2cccc([N+](=O)[O-])c2)c2cccc([N+](=O)[O-])c2)c1 |
|
~%
1-bis(3-nitroph... CAS#:5449-75-2 |
| Literature: Blicke; Cataline Journal of the American Chemical Society, 1938 , vol. 60, p. 419,420 |
|
~%
1-bis(3-nitroph... CAS#:5449-75-2 |
| Literature: Michaelis Justus Liebigs Annalen der Chemie, 1902 , vol. 321, p. 142 |
|
~%
1-bis(3-nitroph... CAS#:5449-75-2 |
| Literature: Michaelis Justus Liebigs Annalen der Chemie, 1902 , vol. 321, p. 142 |
| tris(3-nitrophenyl)arsane oxide |
| tri(m-nitrophenyl)arsine oxide |
| Tris-(3-nitro-phenyl)-arsinoxid |
| tris-(3-nitro-phenyl)-arsine oxide |