Arsine,tris(3-nitrophenyl)- structure
|
Common Name | Arsine,tris(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 5449-74-1 | Molecular Weight | 441.22600 | |
| Density | N/A | Boiling Point | 554.4ºC at 760mmHg | |
| Molecular Formula | C18H12AsN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | tris-(3-nitro-phenyl)-arsine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 554.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C18H12AsN3O6 |
| Molecular Weight | 441.22600 |
| Flash Point | 257.5ºC |
| Exact Mass | 440.99400 |
| PSA | 137.46000 |
| LogP | 3.49700 |
| InChIKey | BWOHSJSBUGJVNA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc([As](c2cccc([N+](=O)[O-])c2)c2cccc([N+](=O)[O-])c2)c1 |
| HS Code | 2931900090 |
|---|
|
~%
Arsine,tris(3-n... CAS#:5449-74-1 |
| Literature: Blicke; Cataline Journal of the American Chemical Society, 1938 , vol. 60, p. 419,420 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| tris-(3-methoxy-phenyl)-arsine |