diphenyl naphthalene-1,8-dicarboxylate structure
|
Common Name | diphenyl naphthalene-1,8-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 5449-83-2 | Molecular Weight | 368.38100 | |
| Density | 1.268g/cm3 | Boiling Point | 561.4ºC at 760 mmHg | |
| Molecular Formula | C24H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.7ºC | |
| Name | Naphthalin-1,8-dicarbonsaeure-diaethylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 561.4ºC at 760 mmHg |
| Molecular Formula | C24H16O4 |
| Molecular Weight | 368.38100 |
| Flash Point | 289.7ºC |
| Exact Mass | 368.10500 |
| PSA | 52.60000 |
| LogP | 5.27820 |
| Index of Refraction | 1.661 |
| InChIKey | GQYNQDRPZODTON-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1cccc2cccc(C(=O)Oc3ccccc3)c12 |
| HS Code | 2917399090 |
|---|
|
~%
diphenyl naphth... CAS#:5449-83-2 |
| Literature: Blicke; Patelski Journal of the American Chemical Society, 1938 , vol. 60, p. 2283 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| naphthalene-1,8-dicarboxylic acid diethyl ester |
| naphthalene-1,8-dicarboxylic acid diphenyl ester |
| Naphthalin-1,8-dicarbonsaeure-diphenylester |