Phenol,2-cyclohexyl-4-(1,1-dimethylethyl)- structure
|
Common Name | Phenol,2-cyclohexyl-4-(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5450-24-8 | Molecular Weight | 232.36100 | |
| Density | 0.985g/cm3 | Boiling Point | 293.1ºC at 760 mmHg | |
| Molecular Formula | C16H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.7ºC | |
| Name | 4-tert-butyl-2-cyclohexylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.985g/cm3 |
|---|---|
| Boiling Point | 293.1ºC at 760 mmHg |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.36100 |
| Flash Point | 135.7ºC |
| Exact Mass | 232.18300 |
| PSA | 20.23000 |
| LogP | 4.73740 |
| Index of Refraction | 1.526 |
| InChIKey | PDFWQXMLRLJXAQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(C2CCCCC2)c1 |
| HS Code | 2907199090 |
|---|
|
~%
Phenol,2-cycloh... CAS#:5450-24-8 |
| Literature: Holcik,J. et al. Collection of Czechoslovak Chemical Communications, 1977 , vol. 42, p. 275 - 282 |
|
~%
Phenol,2-cycloh... CAS#:5450-24-8 |
| Literature: Holcik,J. et al. Collection of Czechoslovak Chemical Communications, 1977 , vol. 42, p. 275 - 282 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Cyclohexyl-4-butyl-phenol |
| 2-Cyclohexyl-4-tert-butylphenol |
| EINECS 226-674-8 |