2-amino-6-methoxy-2,3-dihydroinden-1-one structure
|
Common Name | 2-amino-6-methoxy-2,3-dihydroinden-1-one | ||
|---|---|---|---|---|
| CAS Number | 5450-76-0 | Molecular Weight | 213.66100 | |
| Density | 1.208g/cm3 | Boiling Point | 331.1ºC at 760 mmHg | |
| Molecular Formula | C10H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 2-amino-6-methoxy-2,3-dihydroinden-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.208g/cm3 |
|---|---|
| Boiling Point | 331.1ºC at 760 mmHg |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66100 |
| Flash Point | 177.1ºC |
| Exact Mass | 213.05600 |
| PSA | 52.32000 |
| LogP | 2.26360 |
| Index of Refraction | 1.58 |
| InChIKey | NSQJISUSJNUSRW-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)C(N)C2.Cl |
|
~74%
2-amino-6-metho... CAS#:5450-76-0 |
| Literature: Abbott Laboratories; Abbott GmbH and Co. KG Patent: US2012/40948 A1, 2012 ; Location in patent: Page/Page column 158 ; US 20120040948 A1 |
|
~%
2-amino-6-metho... CAS#:5450-76-0 |
| Literature: Perrone; Berardi; Bettoni; Tortorella; Cuomo; Racagni; Juliano; Rovescalli European Journal of Medicinal Chemistry, 1987 , vol. 22, # 5 p. 417 - 419 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-amino-6-methoxy-1-indanone hydrochloride |
| 2-amino-6-methoxy-2,3-dihydro-1H-inden-1-one hydrochloride |
| 2-amino-6-methoxy-indan-1-one,hydrochloride |
| 2-Amino-6-methoxy-indan-1-on,Hydrochlorid |
| 2-amino-6-methoxy-2,3-dihydroinden-1-one hydrochloride |