benzo[1,3]dioxol-5-yl piperidine-1-carboxylate structure
|
Common Name | benzo[1,3]dioxol-5-yl piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5451-82-1 | Molecular Weight | 249.26200 | |
| Density | 1.299g/cm3 | Boiling Point | 376.3ºC at 760 mmHg | |
| Molecular Formula | C13H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.4ºC | |
| Name | 1,3-benzodioxol-5-yl piperidine-1-carboxylate |
|---|
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 376.3ºC at 760 mmHg |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.26200 |
| Flash Point | 181.4ºC |
| Exact Mass | 249.10000 |
| PSA | 48.00000 |
| LogP | 2.33790 |
| Index of Refraction | 1.577 |
| InChIKey | XHDWIXUNOVEGHY-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc2c(c1)OCO2)N1CCCCC1 |
|
~%
benzo[1,3]dioxo... CAS#:5451-82-1 |
| Literature: Gertler et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |