bis[3-(oxolan-2-yl)propyl] benzene-1,2-dicarboxylate structure
|
Common Name | bis[3-(oxolan-2-yl)propyl] benzene-1,2-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 5453-24-7 | Molecular Weight | 390.47000 | |
| Density | 1.139g/cm3 | Boiling Point | 493.6ºC at 760 mmHg | |
| Molecular Formula | C22H30O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.8ºC | |
| Name | bis[3-(oxolan-2-yl)propyl] benzene-1,2-dicarboxylate |
|---|
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 493.6ºC at 760 mmHg |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.47000 |
| Flash Point | 212.8ºC |
| Exact Mass | 390.20400 |
| PSA | 71.06000 |
| LogP | 3.91860 |
| Index of Refraction | 1.521 |
| InChIKey | HMZMEQBUUZQNNN-UHFFFAOYSA-N |
| SMILES | O=C(OCCCC1CCCO1)c1ccccc1C(=O)OCCCC1CCCO1 |
| HS Code | 2932190090 |
|---|
|
~%
bis[3-(oxolan-2... CAS#:5453-24-7 |
| Literature: Ponomarew et al. Naucn. Ezegodnik Saratovsk. Univ.Chem.Abstr., 1954 , p. 491 Naucn. Ezegodnik Saratovsk. Univ.Chem.Abstr., 1960 , p. 1481 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |