Decanoic acid,1-methyl-1,4,7-heptanetriyl ester (9CI) structure
|
Common Name | Decanoic acid,1-methyl-1,4,7-heptanetriyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5453-36-1 | Molecular Weight | 624.97500 | |
| Density | 0.936g/cm3 | Boiling Point | 652ºC at 760 mmHg | |
| Molecular Formula | C38H72O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | 1,4,7-tris-decanoyloxy-octane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.936g/cm3 |
|---|---|
| Boiling Point | 652ºC at 760 mmHg |
| Molecular Formula | C38H72O6 |
| Molecular Weight | 624.97500 |
| Flash Point | 258.5ºC |
| Exact Mass | 624.53300 |
| PSA | 78.90000 |
| LogP | 11.35560 |
| Index of Refraction | 1.461 |
| InChIKey | YUQPLGDFRZAIPX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OCCCC(CCC(C)OC(=O)CCCCCCCCC)OC(=O)CCCCCCCCC |
| HS Code | 2915900090 |
|---|
|
~%
Decanoic acid,1... CAS#:5453-36-1 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| heptane-1,4,7-triyl tridecanoate |
| 1,4,7-tris-decanoyloxy-heptane |