Benzeneacetic acid, a-(phenylsulfonyl)-, methyl ester structure
|
Common Name | Benzeneacetic acid, a-(phenylsulfonyl)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5453-71-4 | Molecular Weight | 290.33400 | |
| Density | 1.266g/cm3 | Boiling Point | 472.1ºC at 760mmHg | |
| Molecular Formula | C15H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3ºC | |
| Name | methyl 2-(benzenesulfonyl)-2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 472.1ºC at 760mmHg |
| Molecular Formula | C15H14O4S |
| Molecular Weight | 290.33400 |
| Flash Point | 239.3ºC |
| Exact Mass | 290.06100 |
| PSA | 68.82000 |
| LogP | 3.45540 |
| Index of Refraction | 1.577 |
| InChIKey | ZZKNZGNURYASHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)S(=O)(=O)c1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Benzeneacetic a... CAS#:5453-71-4 |
| Literature: Lehto; Shirley Journal of Organic Chemistry, 1957 , vol. 22, p. 989 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzolsulfonyl-phenyl-essigsaeure-methylester |
| benzenesulfonyl-phenyl-acetic acid methyl ester |