5H-1-Pyrindin-2-ol, 4-acetamido-6,7-dihydro- structure
|
Common Name | 5H-1-Pyrindin-2-ol, 4-acetamido-6,7-dihydro- | ||
|---|---|---|---|---|
| CAS Number | 5453-91-8 | Molecular Weight | 192.21400 | |
| Density | 1.26g/cm3 | Boiling Point | 500.4ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.4ºC | |
| Name | N-(2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridin-4-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 500.4ºC at 760 mmHg |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.21400 |
| Flash Point | 231.4ºC |
| Exact Mass | 192.09000 |
| PSA | 61.96000 |
| LogP | 0.89500 |
| Index of Refraction | 1.582 |
| InChIKey | KXSIHOGLYOOZMO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc(=O)[nH]c2c1CCC2 |
| HS Code | 2933990090 |
|---|
|
~%
5H-1-Pyrindin-2... CAS#:5453-91-8 |
| Literature: Schroeder; Rigby Journal of the American Chemical Society, 1949 , vol. 71, p. 2205,2207 |
|
~%
5H-1-Pyrindin-2... CAS#:5453-91-8 |
| Literature: Schroeder; Rigby Journal of the American Chemical Society, 1949 , vol. 71, p. 2205,2207 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| n-(2-oxo-2,5,6,7-tetrahydro-1h-cyclopenta[b]pyridin-4-yl)acetamide |
| N-(2-hydroxy-6,7-dihydro-5H-[1]pyrindin-4-yl)-acetamide |
| WLN: T66 BN DM IU CH&AR-1J8185 |
| 5H-1-Pyrindin-2-ol,7-dihydro |
| TJ CQ EMV1 |