N,N-dimethyl-2-(3,4,5-trimethoxyphenyl)ethanamine structure
|
Common Name | N,N-dimethyl-2-(3,4,5-trimethoxyphenyl)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 54547-01-2 | Molecular Weight | 275.77200 | |
| Density | 1.02g/cm3 | Boiling Point | 318.7ºC at 760 mmHg | |
| Molecular Formula | C13H22ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.2ºC | |
| Name | N,N-dimethyl-2-(3,4,5-trimethoxyphenyl)ethanamine |
|---|
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 318.7ºC at 760 mmHg |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.77200 |
| Flash Point | 90.2ºC |
| Exact Mass | 275.12900 |
| PSA | 30.93000 |
| LogP | 2.61850 |
| Index of Refraction | 1.498 |
| InChIKey | SWODTFSJPQTUJN-UHFFFAOYSA-N |
| SMILES | COc1cc(CCN(C)C)cc(OC)c1OC.Cl |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |