2-Phenyl-2-imidazoline pyromellitate structure
|
Common Name | 2-Phenyl-2-imidazoline pyromellitate | ||
|---|---|---|---|---|
| CAS Number | 54553-90-1 | Molecular Weight | 400.33900 | |
| Density | N/A | Boiling Point | 585.8ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322.1ºC | |
| Name | 2-Phenyl-2-imidazoline pyromellitate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 585.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H16N2O8 |
| Molecular Weight | 400.33900 |
| Flash Point | 322.1ºC |
| Exact Mass | 400.09100 |
| PSA | 173.59000 |
| LogP | 1.28020 |
| InChIKey | TZBVXASHYYFGHZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)O)c(C(=O)O)cc1C(=O)O.c1ccc(C2=NCCN2)cc1 |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R22;R51/53 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ACETOMER 68 |
| 4,5-dihydro-2-phenyl-1h-imidazole 1,2,4,5-benzenetetracarboxylate |
| Mono-Salt of 1,2,4,5-benzenetetracarboxylic acid and 4,5-dihydro-2-phenyl-1H-imidazole |