Trineopentyl orthoborate structure
|
Common Name | Trineopentyl orthoborate | ||
|---|---|---|---|---|
| CAS Number | 5456-06-4 | Molecular Weight | 272.23200 | |
| Density | 0.857g/cm3 | Boiling Point | 273.1ºC at 760 mmHg | |
| Molecular Formula | C15H33BO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 80.8ºC | |
| Name | tris(2,2-dimethylpropyl) borate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.857g/cm3 |
|---|---|
| Boiling Point | 273.1ºC at 760 mmHg |
| Molecular Formula | C15H33BO3 |
| Molecular Weight | 272.23200 |
| Flash Point | 80.8ºC |
| Exact Mass | 272.25200 |
| PSA | 27.69000 |
| LogP | 4.15940 |
| Index of Refraction | 1.418 |
| InChIKey | CTMRSRYEXZZLLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COB(OCC(C)(C)C)OCC(C)(C)C |
| HS Code | 2920909090 |
|---|
|
~%
Trineopentyl or... CAS#:5456-06-4 |
| Literature: Gerrard; Lappert Journal of the Chemical Society, 1955 , p. 3084,3086 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| boric acid trineopentyl ester |
| EINECS 226-712-3 |
| Neopentylborat |
| Trineopentylborat |
| Borsaeure-trineopentylester |
| Trineopentyl orthoborate |