5-methyl-1-octylpyrimidine-2,4-dione structure
|
Common Name | 5-methyl-1-octylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 54565-90-1 | Molecular Weight | 238.32600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-1-octylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22N2O2 |
|---|---|
| Molecular Weight | 238.32600 |
| Exact Mass | 238.16800 |
| PSA | 55.12000 |
| LogP | 2.61780 |
| InChIKey | ZZIRNSWKIIZQSN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1cc(C)c(=O)[nH]c1=O |
|
~19%
5-methyl-1-octy... CAS#:54565-90-1 |
| Literature: Coutouli-Argyropoulou, Evdoxia; Zachariadou, Christina Journal of Heterocyclic Chemistry, 2005 , vol. 42, # 6 p. 1135 - 1142 |
|
~21%
5-methyl-1-octy... CAS#:54565-90-1 |
| Literature: Accetta, Alessandro; Corradini, Roberto; Sforza, Stefano; Tedeschi, Tullia; Brognara, Eleonora; Borgatti, Monica; Gambari, Roberto; Marchelli, Rosangela Journal of Medicinal Chemistry, 2009 , vol. 52, # 1 p. 87 - 94 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4(1H,3H)-Pyrimidinedione,5-methyl-1-octyl |
| 1-octylthymine |
| 5-methyl-1-octylpyrimidine-2,4(1H,3H)-dione |