Pentanoic acid,4-[2-(2,4-dinitrophenyl)hydrazinylidene]- structure
|
Common Name | Pentanoic acid,4-[2-(2,4-dinitrophenyl)hydrazinylidene]- | ||
|---|---|---|---|---|
| CAS Number | 5457-82-9 | Molecular Weight | 296.23600 | |
| Density | 1.51g/cm3 | Boiling Point | 501.9ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.3ºC | |
| Name | 4-[(2,4-dinitrophenyl)hydrazinylidene]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 501.9ºC at 760 mmHg |
| Molecular Formula | C11H12N4O6 |
| Molecular Weight | 296.23600 |
| Flash Point | 257.3ºC |
| Exact Mass | 296.07600 |
| PSA | 153.33000 |
| LogP | 3.27500 |
| Index of Refraction | 1.632 |
| InChIKey | BKRPHSYZQDBACK-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,4-Dinitrophenylhydrazon v. Ethyl-4-oxo-butanoat |
| 3-Formyl-propionsaeure-ethylester-2.4-dinitro-phenylhydrazon |