4-[(6-amino-5H-purin-8-yl)diazenyl]benzenesulfonic acid structure
|
Common Name | 4-[(6-amino-5H-purin-8-yl)diazenyl]benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 5458-50-4 | Molecular Weight | 319.29900 | |
| Density | 1.91g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9N7O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2E)-2-(6-aminopurin-8-ylidene)hydrazinyl]benzenesulfonic acid |
|---|
| Density | 1.91g/cm3 |
|---|---|
| Molecular Formula | C11H9N7O3S |
| Molecular Weight | 319.29900 |
| Exact Mass | 319.04900 |
| PSA | 167.95000 |
| LogP | 3.25920 |
| Index of Refraction | 1.88 |
| InChIKey | UODCGYAALBSTPF-UHFFFAOYSA-N |
| SMILES | Nc1ncnc2nc(N=Nc3ccc(S(=O)(=O)O)cc3)[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~%
4-[(6-amino-5H-... CAS#:5458-50-4 |
| Literature: Burian Chemische Berichte, 1904 , vol. 37, p. 706 Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1907 , vol. 51, p. 426 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |