diethyl 2-(benzo[1,3]dioxol-5-ylmethylidene)propanedioate structure
|
Common Name | diethyl 2-(benzo[1,3]dioxol-5-ylmethylidene)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5458-69-5 | Molecular Weight | 292.28400 | |
| Density | 1.265g/cm3 | Boiling Point | 373.7ºC at 760 mmHg | |
| Molecular Formula | C15H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.3ºC | |
| Name | diethyl 2-(1,3-benzodioxol-5-ylmethylidene)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760 mmHg |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.28400 |
| Flash Point | 163.3ºC |
| Exact Mass | 292.09500 |
| PSA | 71.06000 |
| LogP | 1.92490 |
| Index of Refraction | 1.561 |
| InChIKey | YRPDOPMGYCRHAW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccc2c(c1)OCO2)C(=O)OCC |
|
~87%
diethyl 2-(benz... CAS#:5458-69-5 |
| Literature: Selvaraj, S.; Rajendran, A. S.; Arumugam, N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1987 , vol. 26, # 1-12 p. 1047 - 1049 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Piperonyliden-malonsaeure-diaethylester |
| benzo[1,3]dioxol-5-ylmethylene-malonic acid diethyl ester |
| diethyl 2-(benzo[d][1,3]dioxol-5-ylmethylene)malonate |
| diethyl 3,4-methylenedioxybenzalmalonate |
| Piperonylidene malonic acid diethyl ester |
| Diethyl piperonylidenemalonate |
| Diethyl 2-(1,3-benzodioxol-5-ylmethylene)malonate |