Acetic acid,2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]bis- (9CI) structure
|
Common Name | Acetic acid,2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]bis- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5458-76-4 | Molecular Weight | 240.20900 | |
| Density | 1.365g/cm3 | Boiling Point | 450.4ºC at 760mmHg | |
| Molecular Formula | C11H12O6 | Melting Point | 176-178ºC | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 2-[2-(carboxymethoxy)-4-methylphenoxy]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 450.4ºC at 760mmHg |
| Melting Point | 176-178ºC |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.20900 |
| Flash Point | 177.6ºC |
| Exact Mass | 240.06300 |
| PSA | 93.06000 |
| LogP | 0.92180 |
| Index of Refraction | 1.559 |
| InChIKey | XNWHXCLJBFNQDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCC(=O)O)c(OCC(=O)O)c1 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-METHYLCATECHOL-O,O-DIACETIC ACID |
| 2,2'-[(4-methyl-1,2-phenylene)bis(oxy)]diacetic acid |