2,4-Pteridinediamine,N2,N2-dimethyl-6,7-diphenyl- structure
|
Common Name | 2,4-Pteridinediamine,N2,N2-dimethyl-6,7-diphenyl- | ||
|---|---|---|---|---|
| CAS Number | 5458-96-8 | Molecular Weight | 342.39700 | |
| Density | 1.281g/cm3 | Boiling Point | 532.6ºC at 760mmHg | |
| Molecular Formula | C20H18N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9ºC | |
| Name | 2-N,2-N-dimethyl-6,7-diphenylpteridine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 532.6ºC at 760mmHg |
| Molecular Formula | C20H18N6 |
| Molecular Weight | 342.39700 |
| Flash Point | 275.9ºC |
| Exact Mass | 342.15900 |
| PSA | 80.82000 |
| LogP | 3.98320 |
| Index of Refraction | 1.707 |
| InChIKey | LQNMZCFTZSFPQN-UHFFFAOYSA-N |
| SMILES | CN(C)c1nc(N)c2nc(-c3ccccc3)c(-c3ccccc3)nc2n1 |
|
~%
2,4-Pteridinedi... CAS#:5458-96-8 |
| Literature: Boon Journal of the Chemical Society, 1957 , p. 2151 Journal of the Chemical Society, 1952 , p. 1532 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N2,N2-Dimethyl-6,7-diphenyl-pteridin-2,4-diyldiamin |
| N2,N2-dimethyl-6,7-diphenyl-pteridine-2,4-diyldiamine |
| n2,n2-dimethyl-6,7-diphenylpteridine-2,4-diamine |