Methanone,9H-fluoren-9-yl(4-methyl-1-piperazinyl)-
Modify Date: 2024-04-05 00:47:03
Methanone,9H-fluoren-9-yl(4-methyl-1-piperazinyl)- structure
|
Common Name | Methanone,9H-fluoren-9-yl(4-methyl-1-piperazinyl)- | ||
|---|---|---|---|---|
| CAS Number | 54583-31-2 | Molecular Weight | 292.37500 | |
| Density | 1.197g/cm3 | Boiling Point | 487.4ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | 9H-fluoren-9-yl-(4-methylpiperazin-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.197g/cm3 |
|---|---|
| Boiling Point | 487.4ºC at 760 mmHg |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.37500 |
| Flash Point | 221.9ºC |
| Exact Mass | 292.15800 |
| PSA | 23.55000 |
| LogP | 2.44870 |
| Index of Refraction | 1.627 |
| InChIKey | YTSYTJBQRKOOPY-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)C2c3ccccc3-c3ccccc32)CC1 |
| HS Code | 2933599090 |
|---|
|
~%
Methanone,9H-fl... CAS#:54583-31-2 |
| Literature: Hromatka et al. Monatshefte fuer Chemie, 1954 , vol. 85, p. 1215,1219 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-(4-Methylpiperazinocarbonyl)fluoren |
| 9h-fluoren-9-yl(4-methylpiperazin-1-yl)methanone |
| 1-(Fluoren-9-carbonyl)-4-methyl-piperazin |
| 1-(fluorene-9-carbonyl)-4-methyl-piperazine |