(4-tert-butylphenyl) N,N-dimethylcarbamate structure
|
Common Name | (4-tert-butylphenyl) N,N-dimethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 5461-74-5 | Molecular Weight | 221.29500 | |
| Density | 1.017g/cm3 | Boiling Point | 294ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.6ºC | |
| Name | (4-tert-butylphenyl) N,N-dimethylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 294ºC at 760 mmHg |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 131.6ºC |
| Exact Mass | 221.14200 |
| PSA | 29.54000 |
| LogP | 3.04450 |
| Index of Refraction | 1.503 |
| InChIKey | VQAITWCBMHFNRI-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)Oc1ccc(C(C)(C)C)cc1 |
|
~73%
(4-tert-butylph... CAS#:5461-74-5 |
| Literature: Bedford, Robin B.; Webster, Ruth L.; Mitchell, Charlotte J. Organic and Biomolecular Chemistry, 2009 , vol. 7, # 23 p. 4853 - 4857 |
|
~%
(4-tert-butylph... CAS#:5461-74-5 |
| Literature: Bayer and Co. Patent: DE296889 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 780 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-t-Butylphenyldimethylcarbamat |