(4-tert-butylphenyl) N-phenylcarbamate structure
|
Common Name | (4-tert-butylphenyl) N-phenylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 66018-74-4 | Molecular Weight | 269.33800 | |
| Density | 1.117g/cm3 | Boiling Point | 364.1ºC at 760 mmHg | |
| Molecular Formula | C17H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174ºC | |
| Name | (4-tert-butylphenyl) N-phenylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 364.1ºC at 760 mmHg |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.33800 |
| Flash Point | 174ºC |
| Exact Mass | 269.14200 |
| PSA | 38.33000 |
| LogP | 4.66800 |
| Index of Refraction | 1.582 |
| InChIKey | GNLRBUXTMCTMQI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OC(=O)Nc2ccccc2)cc1 |
|
~%
(4-tert-butylph... CAS#:66018-74-4 |
| Literature: McKinley; Nickels; Sidhu Industrial and Engineering Chemistry, Analytical Edition, 1944 , vol. 16, p. 304 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phenyl-carbamidsaeure-(4-tert-butyl-phenylester) |
| 4-tert-Butylphenyl-N-phenylcarbamate |
| N-Phenyl-thiocarbamidsaeure-o-<4-tert-butyl-phenylester> |
| carbanilic acid 4-tert-butyl-phenyl ester |
| phenyl-carbamic acid-(4-tert-butyl-phenyl ester) |
| 4-tert-butylphenyl phenylcarbamate |