8-amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid structure
|
Common Name | 8-amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 54621-18-0 | Molecular Weight | 201.220 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 372.1±42.0 °C at 760 mmHg | |
| Molecular Formula | C9H15NO4 | Melting Point | 301-304ºC | |
| MSDS | Chinese USA | Flash Point | 178.8±27.9 °C | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 1-amino-4-oxocyclohexanecarboxylic acid ethylene ketal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.1±42.0 °C at 760 mmHg |
| Melting Point | 301-304ºC |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.220 |
| Flash Point | 178.8±27.9 °C |
| Exact Mass | 201.100113 |
| PSA | 81.78000 |
| LogP | -0.17 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | HIIFALCQUKTUHB-UHFFFAOYSA-N |
| SMILES | NC1(C(=O)O)CCC2(CC1)OCCO2 |
| Storage condition | 2-8°C |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 22-41 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Amino-1,4-dioxaspiro[4.5]decane-8-carboxylic acid |
| 8-Amino-1,4-dioxa-spiro[4.5]decane-8-carboxylic acid |
| 1,4-Dioxaspiro[4.5]decane-8-carboxylic acid, 8-amino- |
| MFCD03790906 |