1,3-Isobenzofurandione,4,6-diethoxy-
Modify Date: 2025-08-26 09:35:14
1,3-Isobenzofurandione,4,6-diethoxy- structure
|
Common Name | 1,3-Isobenzofurandione,4,6-diethoxy- | ||
|---|---|---|---|---|
| CAS Number | 5463-18-3 | Molecular Weight | 236.22100 | |
| Density | 1.286g/cm3 | Boiling Point | 416.5ºC at 760 mmHg | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | 4,6-diethoxy-2-benzofuran-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 416.5ºC at 760 mmHg |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22100 |
| Flash Point | 188.4ºC |
| Exact Mass | 236.06800 |
| PSA | 61.83000 |
| LogP | 1.79460 |
| Index of Refraction | 1.547 |
| InChIKey | LSLAWZWDIMPMDT-UHFFFAOYSA-N |
| SMILES | CCOc1cc(OCC)c2c(c1)C(=O)OC2=O |
| HS Code | 2932999099 |
|---|
|
~%
1,3-Isobenzofur... CAS#:5463-18-3 |
| Literature: Oxford; Raistrick Biochemical Journal, 1932 , vol. 26, p. 1902,1906 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5-Diaethoxy-phthalsaeure-anhydrid |
| 3,5-diethoxy-phthalic acid-anhydride |
| 3,5-Diethoxy-phthalsaeureanhydrid |
| 1,3-Isobenzofurandione,4,6-diethoxy |