diethyl 2-acetamido-2-hexyl-propanedioate structure
|
Common Name | diethyl 2-acetamido-2-hexyl-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 5463-91-2 | Molecular Weight | 301.37900 | |
| Density | 1.042g/cm3 | Boiling Point | 398.6ºC at 760 mmHg | |
| Molecular Formula | C15H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.9ºC | |
| Name | diethyl 2-acetamido-2-hexylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.042g/cm3 |
|---|---|
| Boiling Point | 398.6ºC at 760 mmHg |
| Molecular Formula | C15H27NO5 |
| Molecular Weight | 301.37900 |
| Flash Point | 194.9ºC |
| Exact Mass | 301.18900 |
| PSA | 81.70000 |
| LogP | 2.34880 |
| Index of Refraction | 1.456 |
| InChIKey | GIRFDUSAOGWPIM-UHFFFAOYSA-N |
| SMILES | CCCCCCC(NC(C)=O)(C(=O)OCC)C(=O)OCC |
| HS Code | 2924199090 |
|---|
|
~32%
diethyl 2-aceta... CAS#:5463-91-2 |
| Literature: Young, Douglas D.; Torres-Kolbus, Jessica; Deiters, Alexander Bioorganic and Medicinal Chemistry Letters, 2008 , vol. 18, # 20 p. 5478 - 5480 |
|
~%
diethyl 2-aceta... CAS#:5463-91-2 |
| Literature: Albertson Journal of the American Chemical Society, 1946 , vol. 68, p. 452 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetylamino-hexyl-malonic acid diethyl ester |
| DIETHYL 2-ACETAMIDO-2-HEXYL-PROPANEDIOATE |
| diethyl(acetylamino)(hexyl)propanedioate |
| 1-Acetamino-heptan-dicarbonsaeure-(1.1)-diaethylester |
| Acetylamino-hexyl-malonsaeure-diaethylester |
| Acetamino-hexyl-malonsaeure-diaethylester |