2-[2-(4-ethylphenyl)propan-2-yl]butanedioic acid structure
|
Common Name | 2-[2-(4-ethylphenyl)propan-2-yl]butanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 5464-00-6 | Molecular Weight | 264.31700 | |
| Density | 1.158g/cm3 | Boiling Point | 373.7ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194ºC | |
| Name | 2-[2-(4-ethylphenyl)propan-2-yl]butanedioic acid |
|---|
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 373.7ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 194ºC |
| Exact Mass | 264.13600 |
| PSA | 74.60000 |
| LogP | 2.70210 |
| Index of Refraction | 1.536 |
| InChIKey | YOIMXRLWYNJPDF-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(C)(C)C(CC(=O)O)C(=O)O)cc1 |
|
~%
2-[2-(4-ethylph... CAS#:5464-00-6 |
| Literature: Shechter; Barker Journal of Organic Chemistry, 1956 , vol. 21, p. 1473,1474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |