Benzenesulfonamide,N-(2-chlorophenyl)-3-nitro-
Modify Date: 2024-09-16 17:32:54
Benzenesulfonamide,N-(2-chlorophenyl)-3-nitro- structure
|
Common Name | Benzenesulfonamide,N-(2-chlorophenyl)-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 5464-05-1 | Molecular Weight | 312.72900 | |
| Density | 1.545g/cm3 | Boiling Point | 472.7ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | N-(2-chlorophenyl)-3-nitrobenzenesulfonamide |
|---|
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2O4S |
| Molecular Weight | 312.72900 |
| Flash Point | 239.7ºC |
| Exact Mass | 311.99700 |
| PSA | 100.37000 |
| LogP | 4.72600 |
| Index of Refraction | 1.661 |
| HS Code | 2935009090 |
|---|
|
~%
Benzenesulfonam... CAS#:5464-05-1 |
| Literature: Marvel; Kingsbury; Smith Journal of the American Chemical Society, 1925 , vol. 47, p. 167 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |