2-Naphthalenecarboxylicacid, 3-(acetyloxy)- structure
|
Common Name | 2-Naphthalenecarboxylicacid, 3-(acetyloxy)- | ||
|---|---|---|---|---|
| CAS Number | 5464-07-3 | Molecular Weight | 230.21600 | |
| Density | 1.325g/cm3 | Boiling Point | 394.9ºC at 760mmHg | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154ºC | |
| Name | 3-acetyloxynaphthalene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 394.9ºC at 760mmHg |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.21600 |
| Flash Point | 154ºC |
| Exact Mass | 230.05800 |
| PSA | 63.60000 |
| LogP | 2.46330 |
| Index of Refraction | 1.637 |
| InChIKey | DXBBERBOYNPPLM-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1cc2ccccc2cc1C(=O)O |
| HS Code | 2918990090 |
|---|
|
~55%
2-Naphthaleneca... CAS#:5464-07-3 |
| Literature: Allen, Darin Arthur; McGee, Danny Peter Claude; Spencer, Jeffrey R. Patent: US2002/52343 A1, 2002 ; |
|
~82%
2-Naphthaleneca... CAS#:5464-07-3 |
| Literature: Bergeron, Raymond J.; Wiegand, Jan; Wollenweber, Markus; McManis, James S.; Algee, Samuel E.; Ratliff-Thompson, Katie Journal of Medicinal Chemistry, 1996 , vol. 39, # 8 p. 1575 - 1581 |
|
~%
2-Naphthaleneca... CAS#:5464-07-3 |
| Literature: Gilman; Arntzen; Webb Journal of Organic Chemistry, 1945 , vol. 10, p. 374,378 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-acetoxy-2-naphtoic acid |
| 3-(acetyloxy)naphthalene-2-carboxylic acid |
| 3-Acetoxy-naphthalin-2-carbonsaeure |
| 3-Acetoxy-[2]naphthoesaeure |
| 2,3-acetoxynaphthoic acid |
| 3-acetoxy-[2]naphthoic acid |