N,N-diethyl-N-(4-nitrophenyl)ethane-1,2-diamine structure
|
Common Name | N,N-diethyl-N-(4-nitrophenyl)ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 5464-09-5 | Molecular Weight | 237.29800 | |
| Density | 1.127g/cm3 | Boiling Point | 377.9ºC at 760 mmHg | |
| Molecular Formula | C12H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | N--p-nitro-anilin |
|---|
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 377.9ºC at 760 mmHg |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.29800 |
| Flash Point | 182.4ºC |
| Exact Mass | 237.14800 |
| PSA | 61.09000 |
| LogP | 2.94470 |
| Index of Refraction | 1.572 |
| InChIKey | NTSZVWZCBXPHKQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2921590090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |