2-[(4-Nitrophenyl)amino]ethanol structure
|
Common Name | 2-[(4-Nitrophenyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 1965-54-4 | Molecular Weight | 182.17700 | |
| Density | 1.352g/cm3 | Boiling Point | 389.5ºC at 760mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
| Name | 2-(4-nitroanilino)ethanol |
|---|
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 189.4ºC |
| Exact Mass | 182.06900 |
| PSA | 78.08000 |
| LogP | 1.59520 |
| Vapour Pressure | 9.13E-07mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | VPRLWNAMKBZKRR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCO)cc1 |
| HS Code | 2922199090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |