2-[(4-Nitrophenyl)amino]ethanol
![2-[(4-Nitrophenyl)amino]ethanol Structure](https://image.chemsrc.com/caspic/328/1965-54-4.png)
2-[(4-Nitrophenyl)amino]ethanol structure
|
Common Name | 2-[(4-Nitrophenyl)amino]ethanol | ||
|---|---|---|---|---|
| CAS Number | 1965-54-4 | Molecular Weight | 182.17700 | |
| Density | 1.352g/cm3 | Boiling Point | 389.5ºC at 760mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(4-nitroanilino)ethanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 389.5ºC at 760mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.17700 |
| Flash Point | 189.4ºC |
| Exact Mass | 182.06900 |
| PSA | 78.08000 |
| LogP | 1.59520 |
| Vapour Pressure | 9.13E-07mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | VPRLWNAMKBZKRR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCO)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2922199090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 5 | |
CAS#:141-43-5
CAS#:350-46-9
CAS#:636-98-6
CAS#:100-25-4
CAS#:16365-27-8
CAS#:824-78-2
CAS#:100-01-6
CAS#:540-51-2
CAS#:100-00-5![2-[(4-Aminophenyl)amino]ethanol structure](https://image.chemsrc.com/caspic/237/19298-14-7.png)
CAS#:19298-14-7
CAS#:863453-76-3
CAS#:863453-84-3
CAS#:5464-09-5![1-{6a,10-Dihydroxy-1,2-bis(4-hydroxybutyl)-4-[(tetrahydro-2H-pyran-2-yloxy)imino]-1,2,4,5,6,6a,11b,11c-octahydrobenzo[kl]xanthen-6-yl}-3-(1H-indol-2-ylmethyl)-1-propylurea structure](https://image.chemsrc.com/caspic/057/5198-52-7.png)
CAS#:5198-52-7This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-(4-nitroanilino)ethanol? |
| A: Polar surface area (PSA) of 2-(4-nitroanilino)ethanol is 78.08000. |
| Q: What is the SMILES notation of 2-(4-nitroanilino)ethanol? |
| A: SMILES notation of 2-(4-nitroanilino)ethanol is O=[N+]([O-])c1ccc(NCCO)cc1. |
| Q: What is the InChIKey of 2-(4-nitroanilino)ethanol? |
| A: InChIKey of 2-(4-nitroanilino)ethanol is VPRLWNAMKBZKRR-UHFFFAOYSA-N. |
| Q: What are the upstream materials of 2-(4-nitroanilino)ethanol? |
| A: Related upstream materials(CAS) of 2-(4-nitroanilino)ethanol: 141-43-5;350-46-9;636-98-6;100-25-4;16365-27-8;824-78-2;100-01-6;540-51-2;100-00-5. |
| Q: What is the boiling point of 2-(4-nitroanilino)ethanol? |
| A: Boiling point of 2-(4-nitroanilino)ethanol is 389.5ºC at 760mmHg. |
| Q: What is the LogP of 2-(4-nitroanilino)ethanol? |
| A: LogP of 2-(4-nitroanilino)ethanol is 1.59520. |
| Q: What is the English name of 2-(4-nitroanilino)ethanol? |
| A: The English name of 2-(4-nitroanilino)ethanol is 2-(4-nitroanilino)ethanol. |
| Q: What is the CAS number of 2-(4-nitroanilino)ethanol? |
| A: CAS number of 2-(4-nitroanilino)ethanol is 1965-54-4. |
| Q: What is the molecular formula of 2-(4-nitroanilino)ethanol? |
| A: Molecular formula of 2-(4-nitroanilino)ethanol is C8H10N2O3. |
| Q: What is the molecular weight of 2-(4-nitroanilino)ethanol? |
| A: Molecular weight of 2-(4-nitroanilino)ethanol is 182.17700. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |