1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester structure
|
Common Name | 1,1,2,2-Ethanetetracarboxylic acid, tetramethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5464-22-2 | Molecular Weight | 262.21300 | |
| Density | 1.258g/cm3 | Boiling Point | 318.8ºC at 760 mmHg | |
| Molecular Formula | C10H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.6ºC | |
| Name | tetramethyl ethane-1,1,2,2-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 318.8ºC at 760 mmHg |
| Molecular Formula | C10H14O8 |
| Molecular Weight | 262.21300 |
| Flash Point | 137.6ºC |
| Exact Mass | 262.06900 |
| PSA | 105.20000 |
| Index of Refraction | 1.444 |
| InChIKey | YFBFTGJJUOXWIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)C(C(=O)OC)C(=O)OC |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Tetramethoxycarbonylethane |
| 1,1,2,2-ethanetetracarboxylic acid tetraethyl ester |
| ethane-1,1,2,2-tetracarboxylic acid tetramethyl ester |
| 1,1,2,2-Ethanetetracarboxylic acid,tetramethyl ester |
| sym-Tetracarbomethoxyethane |
| EINECS 226-757-9 |
| Aethan-1,1,2,2-tetracarbonsaeure-tetramethylester |