2-(4-aminophenyl)-5H-purin-6-amine structure
|
Common Name | 2-(4-aminophenyl)-5H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 5466-69-3 | Molecular Weight | 226.23700 | |
| Density | 1.65g/cm3 | Boiling Point | 455.9ºC at 760 mmHg | |
| Molecular Formula | C11H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.5ºC | |
| Name | 2-(4-aminophenyl)-7H-purin-6-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.65g/cm3 |
|---|---|
| Boiling Point | 455.9ºC at 760 mmHg |
| Molecular Formula | C11H10N6 |
| Molecular Weight | 226.23700 |
| Flash Point | 229.5ºC |
| Exact Mass | 226.09700 |
| PSA | 106.50000 |
| LogP | 2.34670 |
| Index of Refraction | 1.862 |
| InChIKey | XQPZDMVIOPXTAR-UHFFFAOYSA-N |
| SMILES | Nc1ccc(-c2nc(N)c3[nH]cnc3n2)cc1 |
|
~%
2-(4-aminopheny... CAS#:5466-69-3 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(4-amino-phenyl)-7(9)H-purin-6-ylamine |