2-(4-methoxyphenyl)-5H-purin-6-amine structure
|
Common Name | 2-(4-methoxyphenyl)-5H-purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 5466-70-6 | Molecular Weight | 241.24900 | |
| Density | 1.49g/cm3 | Boiling Point | 419.7ºC at 760 mmHg | |
| Molecular Formula | C12H11N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | 2-(4-methoxyphenyl)-7H-purin-6-amine |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760 mmHg |
| Molecular Formula | C12H11N5O |
| Molecular Weight | 241.24900 |
| Flash Point | 207.6ºC |
| Exact Mass | 241.09600 |
| PSA | 89.71000 |
| LogP | 2.19190 |
| Index of Refraction | 1.745 |
| InChIKey | SZCRELSBSYPEIO-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nc(N)c3[nH]cnc3n2)cc1 |
|
~%
2-(4-methoxyphe... CAS#:5466-70-6 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
|
~%
2-(4-methoxyphe... CAS#:5466-70-6 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
|
~%
2-(4-methoxyphe... CAS#:5466-70-6 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
|
~%
2-(4-methoxyphe... CAS#:5466-70-6 |
| Literature: Taylor; Barton Journal of the American Chemical Society, 1959 , vol. 81, p. 2448,2451 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |