N-[4-(Ethoxycarbonylamino)Phenyl]Carbamic Acid Ethyl Ester structure
|
Common Name | N-[4-(Ethoxycarbonylamino)Phenyl]Carbamic Acid Ethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 5466-93-3 | Molecular Weight | 252.26600 | |
| Density | 1.252g/cm3 | Boiling Point | 299ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | ethyl N-[4-(ethoxycarbonylamino)phenyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 299ºC at 760 mmHg |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.26600 |
| Flash Point | 134.7ºC |
| Exact Mass | 252.11100 |
| PSA | 76.66000 |
| LogP | 2.96940 |
| Index of Refraction | 1.585 |
| InChIKey | OVTZQFJKYDXBAJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(NC(=O)OCC)cc1 |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl 1,4-phenylenediamine-N,N'-dicarboxylate |
| N,N'-p-phenylene-bis-carbamic acid diethyl ester |
| p-Phenylenediurethane |
| N,N-diethoxycarbonyl-1,4-phenylenediamine |
| diethyl N,N'-1,4-phenylenedicarbamate |
| N,N'-p-Phenylen-bis-carbamidsaeure-diaethylester |
| diethyl 1,4-phenylenebiscarbamate |
| N-[4-(Ethoxycarbonylamino)Phenyl]Carbamic Acid Ethyl Ester |
| Rivaroxaban Impurity 54 |