benzyl 4-methylbenzoate structure
|
Common Name | benzyl 4-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 5467-99-2 | Molecular Weight | 226.27000 | |
| Density | 1.107g/cm3 | Boiling Point | 344.2ºC at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.4ºC | |
| Name | benzyl 4-methylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.107g/cm3 |
|---|---|
| Boiling Point | 344.2ºC at 760 mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 154.4ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.35200 |
| Index of Refraction | 1.573 |
| InChIKey | LNXGEZSXCGDUSD-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)OCc2ccccc2)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-MeC6H4CO2Bn |
| (4-Me)C6H4CO2CH2C6H5 |
| Benzyl p-toluate |
| benzyl-4-methylbenzoate |
| 4-methylbenzoic acid benzyl ester |
| benzenemethyl 4-methylbenzoate |
| p-Toluic acid,benzyl ester |