4-(4-bromophenyl)-4-methylpentan-2-one structure
|
Common Name | 4-(4-bromophenyl)-4-methylpentan-2-one | ||
|---|---|---|---|---|
| CAS Number | 54672-48-9 | Molecular Weight | 255.15100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-bromophenyl)-4-methylpentan-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15BrO |
|---|---|
| Molecular Weight | 255.15100 |
| Exact Mass | 254.03100 |
| PSA | 17.07000 |
| LogP | 3.70580 |
| InChIKey | YUWLIVYXKWOESL-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)c1ccc(Br)cc1 |
|
~%
4-(4-bromopheny... CAS#:54672-48-9 |
| Literature: Corse; Rohrmann Journal of the American Chemical Society, 1948 , vol. 70, p. 370 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Pentanone,4-(4-bromophenyl)-4-methyl |
| 4-(4-bromo-phenyl)-4-methyl-pentan-2-one |
| 4-(4-Bromphenyl)-4-methyl-2-pentanon |
| 4-(4-Brom-phenyl)-4-methyl-pentan-2-on |
| 4-(p-Bromphenyl)-4-methyl-2-pentanon |