2-(4-chlorophenyl)-3-phenyl-butanediamide structure
|
Common Name | 2-(4-chlorophenyl)-3-phenyl-butanediamide | ||
|---|---|---|---|---|
| CAS Number | 5468-17-7 | Molecular Weight | 302.75600 | |
| Density | 1.31g/cm3 | Boiling Point | 556.4ºC at 760 mmHg | |
| Molecular Formula | C16H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 290.3ºC | |
| Name | 2-(4-chlorophenyl)-3-phenylbutanediamide |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 556.4ºC at 760 mmHg |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.75600 |
| Flash Point | 290.3ºC |
| Exact Mass | 302.08200 |
| PSA | 86.18000 |
| LogP | 3.57860 |
| Index of Refraction | 1.624 |
| InChIKey | AZDOZGYXOAOENF-UHFFFAOYSA-N |
| SMILES | NC(=O)C(c1ccccc1)C(C(N)=O)c1ccc(Cl)cc1 |
|
~%
2-(4-chlorophen... CAS#:5468-17-7 |
| Literature: McRae; Conn; Platt Canadian Journal of Research, Section B: Chemical Sciences, 1937 , vol. 15, p. 46,49 |
|
~%
2-(4-chlorophen... CAS#:5468-17-7 |
| Literature: McRae; Conn; Platt Canadian Journal of Research, Section B: Chemical Sciences, 1937 , vol. 15, p. 46,49 |