Benzoic acid, o- (o-toluoyl)- structure
|
Common Name | Benzoic acid, o- (o-toluoyl)- | ||
|---|---|---|---|---|
| CAS Number | 5469-51-2 | Molecular Weight | 240.25400 | |
| Density | 1.223g/cm3 | Boiling Point | 419.1ºC at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.4ºC | |
| Name | 2-(2-Methylbenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.223g/cm3 |
|---|---|
| Boiling Point | 419.1ºC at 760 mmHg |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25400 |
| Flash Point | 221.4ºC |
| Exact Mass | 240.07900 |
| PSA | 54.37000 |
| LogP | 2.92420 |
| Index of Refraction | 1.606 |
| InChIKey | FYDVJEVAEUYKOB-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1C(=O)c1ccccc1C(=O)O |
| HS Code | 2918300090 |
|---|
|
~%
Benzoic acid, o... CAS#:5469-51-2 |
| Literature: FMC Corporation Patent: US4766240 A1, 1988 ; |
|
~81%
Benzoic acid, o... CAS#:5469-51-2 |
| Literature: Konosonoks, Armands; Wright, P. John; Tsao, Meng-Lin; Pika, Jana; Novak, Kevin; Mandel, Sarah M.; Krause Bauer, Jeanette A.; Bohne, Cornelia; Gudmundsdottir, Anna D. Journal of Organic Chemistry, 2005 , vol. 70, # 7 p. 2763 - 2770 |
|
~%
Benzoic acid, o... CAS#:5469-51-2 |
| Literature: Brand; Ludwig; Berlin Journal fuer Praktische Chemie (Leipzig), 1925 , vol. <2> 110, p. 32 |
|
~%
Benzoic acid, o... CAS#:5469-51-2
Detail
|
| Literature: Weiss; Korczyn Monatshefte fuer Chemie, 1924 , vol. 45, p. 210 |
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-o-toluoyl-benzoic acid |
| 2-o-Toluoyl-benzoesaeure |
| 2-o-Toluyl-benzoesaeure |
| carboxy-2 methyl-2' benzophenone |