o-tolylmagnesium bromide structure
|
Common Name | o-tolylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 932-31-0 | Molecular Weight | 195.33900 | |
| Density | 1.013 g/mL at 25 °C | Boiling Point | 110.6ºC at 760mmHg | |
| Molecular Formula | C7H7BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 10ºC | |
| Name | o-tolylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.013 g/mL at 25 °C |
|---|---|
| Boiling Point | 110.6ºC at 760mmHg |
| Molecular Formula | C7H7BrMg |
| Molecular Weight | 195.33900 |
| Flash Point | 10ºC |
| Exact Mass | 193.95800 |
| LogP | 2.64080 |
| Appearance of Characters | Solution | Gray to brown |
| InChIKey | YAMQOOCGNXAQGW-UHFFFAOYSA-M |
| SMILES | Cc1[c-]cccc1.[Br-].[Mg+2] |
| Hazard Codes | F+: Highly flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | 16-26-33-36/37/39-45 |
| RIDADR | UN 3399 4.3/PG 1 |
| Packaging Group | II |
| HS Code | 2931900090 |
|
~%
o-tolylmagnesiu... CAS#:932-31-0 |
| Literature: WO2004/5256 A2, ; Page 56-57 ; WO 2004/005256 A2 |
|
~%
o-tolylmagnesiu... CAS#:932-31-0 |
| Literature: US5594023 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 9 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MAGNESIUM,BROMO(2-METHYLPHENYL)- |
| magnesium,methylbenzene,bromide |
| EINECS 213-250-2 |
| o-Tolylmagnesium Bromide |
| 2-Methylphenylmagnesium bromide |
| MFCD00010350 |
| 2-TOLYL MAGNESIUM BROMIDE |