N-[(2-methoxyphenyl)methylideneamino]furan-2-carboxamide structure
|
Common Name | N-[(2-methoxyphenyl)methylideneamino]furan-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 5469-59-0 | Molecular Weight | 308.28500 | |
| Density | 1.554g/cm3 | Boiling Point | 582.2ºC at 760 mmHg | |
| Molecular Formula | C18H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.9ºC | |
| Name | (+-)-11-methyl-9,10-dihydro-9,10-ethano-anthracene-dicarboxylic acid-(11r.12c)-dimethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 582.2ºC at 760 mmHg |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.28500 |
| Flash Point | 319.9ºC |
| Exact Mass | 308.06800 |
| PSA | 91.67000 |
| LogP | 2.05160 |
| Index of Refraction | 1.715 |
| InChIKey | PJNAHQDXNCOGAI-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C2c3ccccc3C(=O)C1(C(=O)O)c1ccccc12 |
|
~%
N-[(2-methoxyph... CAS#:5469-59-0 |
| Literature: Vaughan et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 1748,1751 |
|
~%
N-[(2-methoxyph... CAS#:5469-59-0 |
| Literature: Vaughan et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 1748,1751 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (+-)-11-Oxo-5,11-dihydro-5r,10c-methano-dibenzo[a,d]cyclohepten-10,12syn-dicarbonsaeure |
| (+-)-11-oxo-5,11-dihydro-5r,10c-methano-dibenzo[a,d]cycloheptene-10,12syn-dicarboxylic acid |
| (+-)-11-Methyl-9,10-dihydro-9,10-aethano-anthracen-dicarbonsaeure-(11r.12c)-dimethylester |