1-Naphthalenemethanol,a-(chloromethyl)-4-methoxy- structure
|
Common Name | 1-Naphthalenemethanol,a-(chloromethyl)-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5471-36-3 | Molecular Weight | 236.69400 | |
| Density | 1.245g/cm3 | Boiling Point | 410.4ºC at 760 mmHg | |
| Molecular Formula | C13H13ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202ºC | |
| Name | 2-chloro-1-(4-methoxynaphthalen-1-yl)ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 410.4ºC at 760 mmHg |
| Molecular Formula | C13H13ClO2 |
| Molecular Weight | 236.69400 |
| Flash Point | 202ºC |
| Exact Mass | 236.06000 |
| PSA | 29.46000 |
| LogP | 3.12060 |
| Index of Refraction | 1.619 |
| InChIKey | IBLPGJHJYWZCEG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(O)CCl)c2ccccc12 |
| HS Code | 2909499000 |
|---|
|
~%
1-Naphthaleneme... CAS#:5471-36-3 |
| Literature: Winstein et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 157,158, 160 |
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-Chlor-1-(4-methoxy-[1]naphthyl)-aethanol |
| 2-chloro-1-(4-methoxy-[1]naphthyl)-ethanol |
| (+-)-4-Methoxy-1-(2-chlor-1-hydroxy-aethyl)-naphthalin |
| 2-Chlor-1-(4-methoxy-1-naphthyl)-ethanol |