methyl 2-iodo-6-nitro-benzoate structure
|
Common Name | methyl 2-iodo-6-nitro-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5471-78-3 | Molecular Weight | 307.04200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6INO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-iodo-6-nitro-benzoic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H6INO4 |
|---|---|
| Molecular Weight | 307.04200 |
| Exact Mass | 306.93400 |
| PSA | 72.12000 |
| LogP | 2.50920 |
| InChIKey | MQGSUXFZAANPQE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(I)cccc1[N+](=O)[O-] |
| HS Code | 2916399090 |
|---|
|
~%
methyl 2-iodo-6... CAS#:5471-78-3 |
| Literature: Rule; Smith Journal of the Chemical Society, 1937 , p. 1096,1101 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Jod-6-nitro-benzoesaeure-methylester |
| 2-iodo-6-methyl-pyridine N-oxide |
| methyl 2-iodo-6-nitrobenzoate |
| Pyridine,2-iodo-6-methyl-,1-oxide |